C34H36N2O8 — CID 67023990
6-[5-(5-carboxypentyl)-2,9-dimethoxy-7,14-dioxoquinolino[2,3-b]acridin-12-yl]hexanoic acid (PubChem CID 67023990) has the molecular formula C34H36N2O8 and a molecular weight of 600.67 g/mol. Its IUPAC name is 6-[5-(5-carboxypentyl)-2,9-dimethoxy-7,14-dioxoquinolino[2,3-b]acridin-12-yl]hexanoic acid.
| Compound Name | 6-[5-(5-carboxypentyl)-2,9-dimethoxy-7,14-dioxoquinolino[2,3-b]acridin-12-yl]hexanoic acid |
|---|---|
| PubChem CID | 67023990 |
| Molecular Formula | C34H36N2O8 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 6-[5-(5-carboxypentyl)-2,9-dimethoxy-7,14-dioxoquinolino[2,3-b]acridin-12-yl]hexanoic acid |
| SMILES | COc1ccc2c(c1)c(=O)c1cc3c(cc1n2CCCCCC(=O)O)c(=O)c1cc(OC)ccc1n3CCCCCC(=O)O |
| InChI | InChI=1S/C34H36N2O8/c1-43-21-11-13-27-23(17-21)33(41)25-19-30-26(20-29(25)35(27)15-7-3-5-9-31(37)38)34(42)24-18-22(44-2)12-14-28(24)36(30)16-8-4-6-10-32(39)40/h11-14,17-20H,3-10,15-16H2,1-2H3,(H,37,38)(H,39,40) |
| InChIKey | OGTLLLRTVHVDII-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|