C50H44N2O4 — CID 138622675
5,12-dibutyl-2,9-bis(6-methoxynaphthalen-2-yl)quinolino[2,3-b]acridine-7,14-dione (PubChem CID 138622675) has the molecular formula C50H44N2O4 and a molecular weight of 736.91 g/mol. Its IUPAC name is 5,12-dibutyl-2,9-bis(6-methoxynaphthalen-2-yl)quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5,12-dibutyl-2,9-bis(6-methoxynaphthalen-2-yl)quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 138622675 |
| Molecular Formula | C50H44N2O4 |
| Molecular Weight | 736.91 g/mol |
| Exact Mass | 736.33 |
| IUPAC Name | 5,12-dibutyl-2,9-bis(6-methoxynaphthalen-2-yl)quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCCCn1c2ccc(-c3ccc4cc(OC)ccc4c3)cc2c(=O)c2cc3c(cc21)c(=O)c1cc(-c2ccc4cc(OC)ccc4c2)ccc1n3CCCC |
| InChI | InChI=1S/C50H44N2O4/c1-5-7-21-51-45-19-15-37(31-9-11-35-25-39(55-3)17-13-33(35)23-31)27-41(45)49(53)43-30-48-44(29-47(43)51)50(54)42-28-38(16-20-46(42)52(48)22-8-6-2)32-10-12-36-26-40(56-4)18-14-34(36)24-32/h9-20,23-30H,5-8,21-22H2,1-4H3 |
| InChIKey | VUCPQHIEBXBJJW-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.91 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|