C17H15Br2NO — CID 86036844
2,7-dibromo-10-butylacridin-9-one (PubChem CID 86036844) has the molecular formula C17H15Br2NO and a molecular weight of 409.12 g/mol. Its IUPAC name is 2,7-dibromo-10-butylacridin-9-one.
| Compound Name | 2,7-dibromo-10-butylacridin-9-one |
|---|---|
| PubChem CID | 86036844 |
| Molecular Formula | C17H15Br2NO |
| Molecular Weight | 409.12 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 2,7-dibromo-10-butylacridin-9-one |
| SMILES | CCCCn1c2ccc(Br)cc2c(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C17H15Br2NO/c1-2-3-8-20-15-6-4-11(18)9-13(15)17(21)14-10-12(19)5-7-16(14)20/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | QADZOKWGNOUDOU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.12 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|