C44H44Br2N4 — CID 101382330
1-(6-bromo-9-hexylcarbazol-3-yl)-N-[4-[(6-bromo-9-hexylcarbazol-3-yl)methylideneamino]phenyl]methanimine (PubChem CID 101382330) has the molecular formula C44H44Br2N4 and a molecular weight of 788.67 g/mol. Its IUPAC name is 1-(6-bromo-9-hexylcarbazol-3-yl)-N-[4-[(6-bromo-9-hexylcarbazol-3-yl)methylideneamino]phenyl]methanimine.
| Compound Name | 1-(6-bromo-9-hexylcarbazol-3-yl)-N-[4-[(6-bromo-9-hexylcarbazol-3-yl)methylideneamino]phenyl]methanimine |
|---|---|
| PubChem CID | 101382330 |
| Molecular Formula | C44H44Br2N4 |
| Molecular Weight | 788.67 g/mol |
| Exact Mass | 786.19 |
| IUPAC Name | 1-(6-bromo-9-hexylcarbazol-3-yl)-N-[4-[(6-bromo-9-hexylcarbazol-3-yl)methylideneamino]phenyl]methanimine |
| SMILES | CCCCCCn1c2ccc(Br)cc2c2cc(/C=N/c3ccc(/N=C/c4ccc5c(c4)c4cc(Br)ccc4n5CCCCCC)cc3)ccc21 |
| InChI | InChI=1S/C44H44Br2N4/c1-3-5-7-9-23-49-41-19-11-31(25-37(41)39-27-33(45)13-21-43(39)49)29-47-35-15-17-36(18-16-35)48-30-32-12-20-42-38(26-32)40-28-34(46)14-22-44(40)50(42)24-10-8-6-4-2/h11-22,25-30H,3-10,23-24H2,1-2H3/b47-29+,48-30+ |
| InChIKey | AEFQETODKKLBHD-GWSDYOLYSA-N |
| XLogP | 14.09 |
| TPSA | 34.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.67 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|