C19H27NO4 — CID 139718108
3-butoxy-1-butyl-4,7-dimethoxyquinolin-2-one (PubChem CID 139718108) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-butoxy-1-butyl-4,7-dimethoxyquinolin-2-one.
| Compound Name | 3-butoxy-1-butyl-4,7-dimethoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718108 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 3-butoxy-1-butyl-4,7-dimethoxyquinolin-2-one |
| SMILES | CCCCOc1c(OC)c2ccc(OC)cc2n(CCCC)c1=O |
| InChI | InChI=1S/C19H27NO4/c1-5-7-11-20-16-13-14(22-3)9-10-15(16)17(23-4)18(19(20)21)24-12-8-6-2/h9-10,13H,5-8,11-12H2,1-4H3 |
| InChIKey | MSBTXRRODBCCFP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|