C22H33NO4 — CID 139717374
3,7-dimethoxy-1-octyl-4-propan-2-yloxyquinolin-2-one (PubChem CID 139717374) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is 3,7-dimethoxy-1-octyl-4-propan-2-yloxyquinolin-2-one.
| Compound Name | 3,7-dimethoxy-1-octyl-4-propan-2-yloxyquinolin-2-one |
|---|---|
| PubChem CID | 139717374 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | 3,7-dimethoxy-1-octyl-4-propan-2-yloxyquinolin-2-one |
| SMILES | CCCCCCCCn1c(=O)c(OC)c(OC(C)C)c2ccc(OC)cc21 |
| InChI | InChI=1S/C22H33NO4/c1-6-7-8-9-10-11-14-23-19-15-17(25-4)12-13-18(19)20(27-16(2)3)21(26-5)22(23)24/h12-13,15-16H,6-11,14H2,1-5H3 |
| InChIKey | DOWAEUHJZPHGMG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|