C50H53NO4 — CID 122366143
9-decyl-2,3,6,7-tetrakis(4-methoxyphenyl)carbazole (PubChem CID 122366143) has the molecular formula C50H53NO4 and a molecular weight of 731.98 g/mol. Its IUPAC name is 9-decyl-2,3,6,7-tetrakis(4-methoxyphenyl)carbazole.
| Compound Name | 9-decyl-2,3,6,7-tetrakis(4-methoxyphenyl)carbazole |
|---|---|
| PubChem CID | 122366143 |
| Molecular Formula | C50H53NO4 |
| Molecular Weight | 731.98 g/mol |
| Exact Mass | 731.40 |
| IUPAC Name | 9-decyl-2,3,6,7-tetrakis(4-methoxyphenyl)carbazole |
| SMILES | CCCCCCCCCCn1c2cc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)cc2c2cc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)cc21 |
| InChI | InChI=1S/C50H53NO4/c1-6-7-8-9-10-11-12-13-30-51-49-33-45(37-18-26-41(54-4)27-19-37)43(35-14-22-39(52-2)23-15-35)31-47(49)48-32-44(36-16-24-40(53-3)25-17-36)46(34-50(48)51)38-20-28-42(55-5)29-21-38/h14-29,31-34H,6-13,30H2,1-5H3 |
| InChIKey | BEFABBGOKIZUKY-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 41.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.98 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|