C15H22N2 — CID 82495320
2-(7-ethyl-1,2-dimethylindol-3-yl)propan-1-amine (PubChem CID 82495320) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-(7-ethyl-1,2-dimethylindol-3-yl)propan-1-amine.
| Compound Name | 2-(7-ethyl-1,2-dimethylindol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 82495320 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 2-(7-ethyl-1,2-dimethylindol-3-yl)propan-1-amine |
| SMILES | CCc1cccc2c(C(C)CN)c(C)n(C)c12 |
| InChI | InChI=1S/C15H22N2/c1-5-12-7-6-8-13-14(10(2)9-16)11(3)17(4)15(12)13/h6-8,10H,5,9,16H2,1-4H3 |
| InChIKey | YERXXXBPQIZKOL-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|