C16H25N3 — CID 82500433
1-(7-ethyl-1,2-dimethylindol-3-yl)-N,N-dimethylethane-1,2-diamine (PubChem CID 82500433) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-(7-ethyl-1,2-dimethylindol-3-yl)-N,N-dimethylethane-1,2-diamine.
| Compound Name | 1-(7-ethyl-1,2-dimethylindol-3-yl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 82500433 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-(7-ethyl-1,2-dimethylindol-3-yl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CCc1cccc2c(C(CN)N(C)C)c(C)n(C)c12 |
| InChI | InChI=1S/C16H25N3/c1-6-12-8-7-9-13-15(14(10-17)18(3)4)11(2)19(5)16(12)13/h7-9,14H,6,10,17H2,1-5H3 |
| InChIKey | OJGPCOMGWILYGR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|