C13H15NO — CID 82491522
7-ethyl-1,3-dimethylindole-2-carbaldehyde (PubChem CID 82491522) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 7-ethyl-1,3-dimethylindole-2-carbaldehyde.
| Compound Name | 7-ethyl-1,3-dimethylindole-2-carbaldehyde |
|---|---|
| PubChem CID | 82491522 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 7-ethyl-1,3-dimethylindole-2-carbaldehyde |
| SMILES | CCc1cccc2c(C)c(C=O)n(C)c12 |
| InChI | InChI=1S/C13H15NO/c1-4-10-6-5-7-11-9(2)12(8-15)14(3)13(10)11/h5-8H,4H2,1-3H3 |
| InChIKey | LSAKAYLAOWMFHJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|