C12H13NO — CID 105442636
1,3,4-trimethylindole-2-carbaldehyde (PubChem CID 105442636) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1,3,4-trimethylindole-2-carbaldehyde.
| Compound Name | 1,3,4-trimethylindole-2-carbaldehyde |
|---|---|
| PubChem CID | 105442636 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1,3,4-trimethylindole-2-carbaldehyde |
| SMILES | Cc1cccc2c1c(C)c(C=O)n2C |
| InChI | InChI=1S/C12H13NO/c1-8-5-4-6-10-12(8)9(2)11(7-14)13(10)3/h4-7H,1-3H3 |
| InChIKey | JLVVUVDXCQSHIC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|