C12H10N2O — CID 105451423
2-formyl-1,3-dimethylindole-7-carbonitrile (PubChem CID 105451423) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-formyl-1,3-dimethylindole-7-carbonitrile.
| Compound Name | 2-formyl-1,3-dimethylindole-7-carbonitrile |
|---|---|
| PubChem CID | 105451423 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-formyl-1,3-dimethylindole-7-carbonitrile |
| SMILES | Cc1c(C=O)n(C)c2c(C#N)cccc12 |
| InChI | InChI=1S/C12H10N2O/c1-8-10-5-3-4-9(6-13)12(10)14(2)11(8)7-15/h3-5,7H,1-2H3 |
| InChIKey | QZFOGLUEVBVEFA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 45.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|