C14H21N3 — CID 96599431
(1S)-1-(7-ethyl-1H-indol-3-yl)-N,N-dimethylethane-1,2-diamine (PubChem CID 96599431) has the molecular formula C14H21N3 and a molecular weight of 231.34 g/mol. Its IUPAC name is (1S)-1-(7-ethyl-1H-indol-3-yl)-N,N-dimethylethane-1,2-diamine.
| Compound Name | (1S)-1-(7-ethyl-1H-indol-3-yl)-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 96599431 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (1S)-1-(7-ethyl-1H-indol-3-yl)-N,N-dimethylethane-1,2-diamine |
| SMILES | CCc1cccc2c([C@@H](CN)N(C)C)c[nH]c12 |
| InChI | InChI=1S/C14H21N3/c1-4-10-6-5-7-11-12(9-16-14(10)11)13(8-15)17(2)3/h5-7,9,13,16H,4,8,15H2,1-3H3/t13-/m1/s1 |
| InChIKey | WUWKHQMLFFVFKW-CYBMUJFWSA-N |
| XLogP | 2.29 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |