C14H20N2 — CID 154181307
1-(7-ethyl-1H-indol-3-yl)butan-2-amine (PubChem CID 154181307) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1-(7-ethyl-1H-indol-3-yl)butan-2-amine.
| Compound Name | 1-(7-ethyl-1H-indol-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 154181307 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1-(7-ethyl-1H-indol-3-yl)butan-2-amine |
| SMILES | CCc1cccc2c(CC(N)CC)c[nH]c12 |
| InChI | InChI=1S/C14H20N2/c1-3-10-6-5-7-13-11(8-12(15)4-2)9-16-14(10)13/h5-7,9,12,16H,3-4,8,15H2,1-2H3 |
| InChIKey | BKOXXFSLIPCHEB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |