C14H16N2O2 — CID 138470175
(2S)-2-amino-3-(7-prop-2-enyl-1H-indol-3-yl)propanoic acid (PubChem CID 138470175) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2S)-2-amino-3-(7-prop-2-enyl-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(7-prop-2-enyl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 138470175 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (2S)-2-amino-3-(7-prop-2-enyl-1H-indol-3-yl)propanoic acid |
| SMILES | C=CCc1cccc2c(C[C@H](N)C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C14H16N2O2/c1-2-4-9-5-3-6-11-10(8-16-13(9)11)7-12(15)14(17)18/h2-3,5-6,8,12,16H,1,4,7,15H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | OEEBTMXXSPUWGR-LBPRGKRZSA-N |
| XLogP | 1.85 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|