C25H20N2O2 — CID 162462330
(2S)-2-amino-3-(7-phenanthren-4-yl-1H-indol-3-yl)propanoic acid (PubChem CID 162462330) has the molecular formula C25H20N2O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (2S)-2-amino-3-(7-phenanthren-4-yl-1H-indol-3-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(7-phenanthren-4-yl-1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 162462330 |
| Molecular Formula | C25H20N2O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2S)-2-amino-3-(7-phenanthren-4-yl-1H-indol-3-yl)propanoic acid |
| SMILES | N[C@@H](Cc1c[nH]c2c(-c3cccc4ccc5ccccc5c34)cccc12)C(=O)O |
| InChI | InChI=1S/C25H20N2O2/c26-22(25(28)29)13-17-14-27-24-19(17)8-4-10-21(24)20-9-3-6-16-12-11-15-5-1-2-7-18(15)23(16)20/h1-12,14,22,27H,13,26H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | VWFBTBWVLDOMLW-QFIPXVFZSA-N |
| XLogP | 5.10 |
| TPSA | 79.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|