C14H20N2O3 — CID 145142398
2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid;ethane (PubChem CID 145142398) has the molecular formula C14H20N2O3 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 145142398 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 2-amino-3-(7-methoxy-1H-indol-3-yl)propanoic acid;ethane |
| SMILES | CC.COc1cccc2c(CC(N)C(=O)O)c[nH]c12 |
| InChI | InChI=1S/C12H14N2O3.C2H6/c1-17-10-4-2-3-8-7(6-14-11(8)10)5-9(13)12(15)16;1-2/h2-4,6,9,14H,5,13H2,1H3,(H,15,16);1-2H3 |
| InChIKey | UMWMHKCSRLXEOV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |