C15H22N2O3 — CID 142339146
2-amino-3-(7-methoxy-1-methylindol-3-yl)propanoic acid;ethane (PubChem CID 142339146) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-amino-3-(7-methoxy-1-methylindol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(7-methoxy-1-methylindol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 142339146 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 2-amino-3-(7-methoxy-1-methylindol-3-yl)propanoic acid;ethane |
| SMILES | CC.COc1cccc2c(CC(N)C(=O)O)cn(C)c12 |
| InChI | InChI=1S/C13H16N2O3.C2H6/c1-15-7-8(6-10(14)13(16)17)9-4-3-5-11(18-2)12(9)15;1-2/h3-5,7,10H,6,14H2,1-2H3,(H,16,17);1-2H3 |
| InChIKey | LGRLWQXJFGVQQB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |