C16H22N2O2 — CID 145142529
2-amino-3-(7-ethenyl-1-methylindol-3-yl)propanoic acid;ethane (PubChem CID 145142529) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-amino-3-(7-ethenyl-1-methylindol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(7-ethenyl-1-methylindol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 145142529 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-amino-3-(7-ethenyl-1-methylindol-3-yl)propanoic acid;ethane |
| SMILES | C=Cc1cccc2c(CC(N)C(=O)O)cn(C)c12.CC |
| InChI | InChI=1S/C14H16N2O2.C2H6/c1-3-9-5-4-6-11-10(7-12(15)14(17)18)8-16(2)13(9)11;1-2/h3-6,8,12H,1,7,15H2,2H3,(H,17,18);1-2H3 |
| InChIKey | ZFHWJXMTAUWKKE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |