C13H15ClN2O2 — CID 71169916
2-amino-3-(7-chloro-1,5-dimethylindol-3-yl)propanoic acid (PubChem CID 71169916) has the molecular formula C13H15ClN2O2 and a molecular weight of 266.73 g/mol. Its IUPAC name is 2-amino-3-(7-chloro-1,5-dimethylindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(7-chloro-1,5-dimethylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 71169916 |
| Molecular Formula | C13H15ClN2O2 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-amino-3-(7-chloro-1,5-dimethylindol-3-yl)propanoic acid |
| SMILES | Cc1cc(Cl)c2c(c1)c(CC(N)C(=O)O)cn2C |
| InChI | InChI=1S/C13H15ClN2O2/c1-7-3-9-8(5-11(15)13(17)18)6-16(2)12(9)10(14)4-7/h3-4,6,11H,5,15H2,1-2H3,(H,17,18) |
| InChIKey | IIXQVDVQCPRBBS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |