C19H23N3O2 — CID 142339045
2-amino-3-(1-methyl-6-pyridin-4-ylindol-3-yl)propanoic acid;ethane (PubChem CID 142339045) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-amino-3-(1-methyl-6-pyridin-4-ylindol-3-yl)propanoic acid;ethane.
| Compound Name | 2-amino-3-(1-methyl-6-pyridin-4-ylindol-3-yl)propanoic acid;ethane |
|---|---|
| PubChem CID | 142339045 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-amino-3-(1-methyl-6-pyridin-4-ylindol-3-yl)propanoic acid;ethane |
| SMILES | CC.Cn1cc(CC(N)C(=O)O)c2ccc(-c3ccncc3)cc21 |
| InChI | InChI=1S/C17H17N3O2.C2H6/c1-20-10-13(8-15(18)17(21)22)14-3-2-12(9-16(14)20)11-4-6-19-7-5-11;1-2/h2-7,9-10,15H,8,18H2,1H3,(H,21,22);1-2H3 |
| InChIKey | AMLAQJCOJAVJDD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |