C18H25N3O3 — CID 83984029
2-amino-3-[6-(2-ethoxyethyl)-1-methyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid (PubChem CID 83984029) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-amino-3-[6-(2-ethoxyethyl)-1-methyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid.
| Compound Name | 2-amino-3-[6-(2-ethoxyethyl)-1-methyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 83984029 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 2-amino-3-[6-(2-ethoxyethyl)-1-methyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid |
| SMILES | CCOCCN1Cc2cc3c(CC(N)C(=O)O)cn(C)c3cc2C1 |
| InChI | InChI=1S/C18H25N3O3/c1-3-24-5-4-21-10-12-6-15-14(7-16(19)18(22)23)9-20(2)17(15)8-13(12)11-21/h6,8-9,16H,3-5,7,10-11,19H2,1-2H3,(H,22,23) |
| InChIKey | HLWLGJMVOYLXEM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|