C26H23NO4 — CID 123250295
2-amino-3-[2-[2-(2-carboxyethenyl)-3-(2-ethenylphenyl)phenyl]phenyl]propanoic acid (PubChem CID 123250295) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-amino-3-[2-[2-(2-carboxyethenyl)-3-(2-ethenylphenyl)phenyl]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[2-[2-(2-carboxyethenyl)-3-(2-ethenylphenyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123250295 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-amino-3-[2-[2-(2-carboxyethenyl)-3-(2-ethenylphenyl)phenyl]phenyl]propanoic acid |
| SMILES | C=Cc1ccccc1-c1cccc(-c2ccccc2CC(N)C(=O)O)c1C=CC(=O)O |
| InChI | InChI=1S/C26H23NO4/c1-2-17-8-3-5-10-19(17)21-12-7-13-22(23(21)14-15-25(28)29)20-11-6-4-9-18(20)16-24(27)26(30)31/h2-15,24H,1,16,27H2,(H,28,29)(H,30,31) |
| InChIKey | XBYLMJJQBHMUBO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|