C16H24N2O — CID 142339069
3-amino-4-(1,7-dimethylindol-3-yl)but-1-en-2-ol;ethane (PubChem CID 142339069) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-amino-4-(1,7-dimethylindol-3-yl)but-1-en-2-ol;ethane.
| Compound Name | 3-amino-4-(1,7-dimethylindol-3-yl)but-1-en-2-ol;ethane |
|---|---|
| PubChem CID | 142339069 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-amino-4-(1,7-dimethylindol-3-yl)but-1-en-2-ol;ethane |
| SMILES | C=C(O)C(N)Cc1cn(C)c2c(C)cccc12.CC |
| InChI | InChI=1S/C14H18N2O.C2H6/c1-9-5-4-6-12-11(7-13(15)10(2)17)8-16(3)14(9)12;1-2/h4-6,8,13,17H,2,7,15H2,1,3H3;1-2H3 |
| InChIKey | FPTKLTAGBXQMPI-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|