About 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane
3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane (PubChem CID 153346442) has the molecular formula C16H24N2O
and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane.
Molecular Properties
| Compound Name | 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane |
| PubChem CID | 153346442 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane |
| SMILES | C=C(O)C(N)Cc1c(C)n(C)c2ccccc12.CC |
| InChI | InChI=1S/C14H18N2O.C2H6/c1-9-12(8-13(15)10(2)17)11-6-4-5-7-14(11)16(9)3;1-2/h4-7,13,17H,2,8,15H2,1,3H3;1-2H3 |
| InChIKey | AMCJXZDYWLYMCO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane?
The IUPAC name of 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane (CID 153346442) is 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane.
What is the SMILES notation for 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane?
The canonical SMILES for 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane is C=C(O)C(N)Cc1c(C)n(C)c2ccccc12.CC.
What is the InChIKey of 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane?
The InChIKey is AMCJXZDYWLYMCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O.C2H6/c1-9-12(8-13(15)10(2)17)11-6-4-5-7-14(11)16(9)3;1-2/h4-7,13,17H,2,8,15H2,1,3H3;1-2H3.
What are the key properties of 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane?
3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane has a molecular weight of 260.38 g/mol, XLogP of 3.45, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-(1,2-dimethylindol-3-yl)but-1-en-2-ol;ethane is sourced from PubChem (CID 153346442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).