C14H18N2O2S — CID 122499629
2-amino-3-(1,2-dimethyl-6-methylsulfanylindol-3-yl)propanoic acid (PubChem CID 122499629) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-amino-3-(1,2-dimethyl-6-methylsulfanylindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(1,2-dimethyl-6-methylsulfanylindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122499629 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-amino-3-(1,2-dimethyl-6-methylsulfanylindol-3-yl)propanoic acid |
| SMILES | CSc1ccc2c(CC(N)C(=O)O)c(C)n(C)c2c1 |
| InChI | InChI=1S/C14H18N2O2S/c1-8-11(7-12(15)14(17)18)10-5-4-9(19-3)6-13(10)16(8)2/h4-6,12H,7,15H2,1-3H3,(H,17,18) |
| InChIKey | INEGGIRNWOHXAU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|