C13H16N4O4 — CID 122473907
2-amino-3-(5-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid (PubChem CID 122473907) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 2-amino-3-(5-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(5-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 122473907 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-amino-3-(5-amino-1,2-dimethyl-4-nitroindol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(N)C(=O)O)c2c([N+](=O)[O-])c(N)ccc2n1C |
| InChI | InChI=1S/C13H16N4O4/c1-6-7(5-9(15)13(18)19)11-10(16(6)2)4-3-8(14)12(11)17(20)21/h3-4,9H,5,14-15H2,1-2H3,(H,18,19) |
| InChIKey | CRMDUKCNLFHOIB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|