C16H19N3O — CID 174117279
3-amino-4-(7-amino-4-ethynyl-1,2-dimethylindol-3-yl)butan-2-one (PubChem CID 174117279) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-amino-4-(7-amino-4-ethynyl-1,2-dimethylindol-3-yl)butan-2-one.
| Compound Name | 3-amino-4-(7-amino-4-ethynyl-1,2-dimethylindol-3-yl)butan-2-one |
|---|---|
| PubChem CID | 174117279 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-amino-4-(7-amino-4-ethynyl-1,2-dimethylindol-3-yl)butan-2-one |
| SMILES | C#Cc1ccc(N)c2c1c(CC(N)C(C)=O)c(C)n2C |
| InChI | InChI=1S/C16H19N3O/c1-5-11-6-7-13(17)16-15(11)12(9(2)19(16)4)8-14(18)10(3)20/h1,6-7,14H,8,17-18H2,2-4H3 |
| InChIKey | HTSDVUFGIORZPU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|