C16H21N3O2 — CID 83984309
2-amino-3-(1,2,6-trimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)propanoic acid (PubChem CID 83984309) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-amino-3-(1,2,6-trimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)propanoic acid.
| Compound Name | 2-amino-3-(1,2,6-trimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 83984309 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 2-amino-3-(1,2,6-trimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)propanoic acid |
| SMILES | Cc1c(CC(N)C(=O)O)c2cc3c(cc2n1C)CN(C)C3 |
| InChI | InChI=1S/C16H21N3O2/c1-9-12(6-14(17)16(20)21)13-4-10-7-18(2)8-11(10)5-15(13)19(9)3/h4-5,14H,6-8,17H2,1-3H3,(H,20,21) |
| InChIKey | XTJNZGJURKMWEQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|