C19H26N2O2 — CID 83984236
ethyl 2-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetate (PubChem CID 83984236) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is ethyl 2-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetate.
| Compound Name | ethyl 2-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetate |
|---|---|
| PubChem CID | 83984236 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | ethyl 2-(2,6-dimethyl-1-propyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetate |
| SMILES | CCCn1c(C)c(CC(=O)OCC)c2cc3c(cc21)CN(C)C3 |
| InChI | InChI=1S/C19H26N2O2/c1-5-7-21-13(3)16(10-19(22)23-6-2)17-8-14-11-20(4)12-15(14)9-18(17)21/h8-9H,5-7,10-12H2,1-4H3 |
| InChIKey | JZDFOANIZYPILA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|