C18H25N3O2 — CID 83984295
3-(1-ethyl-2,6-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-(methylamino)propanoic acid (PubChem CID 83984295) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 3-(1-ethyl-2,6-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-(methylamino)propanoic acid.
| Compound Name | 3-(1-ethyl-2,6-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-(methylamino)propanoic acid |
|---|---|
| PubChem CID | 83984295 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-(1-ethyl-2,6-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-(methylamino)propanoic acid |
| SMILES | CCn1c(C)c(CC(NC)C(=O)O)c2cc3c(cc21)CN(C)C3 |
| InChI | InChI=1S/C18H25N3O2/c1-5-21-11(2)14(8-16(19-3)18(22)23)15-6-12-9-20(4)10-13(12)7-17(15)21/h6-7,16,19H,5,8-10H2,1-4H3,(H,22,23) |
| InChIKey | NRJAHAXOGVETSH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|