C19H26N2O2 — CID 83984356
methyl 3-(6-ethyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoate (PubChem CID 83984356) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl 3-(6-ethyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoate.
| Compound Name | methyl 3-(6-ethyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoate |
|---|---|
| PubChem CID | 83984356 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | methyl 3-(6-ethyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)-2-methylpropanoate |
| SMILES | CCN1Cc2cc3c(CC(C)C(=O)OC)c(C)n(C)c3cc2C1 |
| InChI | InChI=1S/C19H26N2O2/c1-6-21-10-14-8-17-16(7-12(2)19(22)23-5)13(3)20(4)18(17)9-15(14)11-21/h8-9,12H,6-7,10-11H2,1-5H3 |
| InChIKey | BWNYKTPFZBEYPZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|