C19H26N2O3 — CID 83984471
3-[6-(2-ethoxyethyl)-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid (PubChem CID 83984471) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-[6-(2-ethoxyethyl)-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid.
| Compound Name | 3-[6-(2-ethoxyethyl)-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 83984471 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 3-[6-(2-ethoxyethyl)-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl]propanoic acid |
| SMILES | CCOCCN1Cc2cc3c(CCC(=O)O)c(C)n(C)c3cc2C1 |
| InChI | InChI=1S/C19H26N2O3/c1-4-24-8-7-21-11-14-9-17-16(5-6-19(22)23)13(2)20(3)18(17)10-15(14)12-21/h9-10H,4-8,11-12H2,1-3H3,(H,22,23) |
| InChIKey | FOCGCBSAZAYSFR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|