C21H22N2O2 — CID 83984399
2-(6-benzyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetic acid (PubChem CID 83984399) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-(6-benzyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetic acid.
| Compound Name | 2-(6-benzyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetic acid |
|---|---|
| PubChem CID | 83984399 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 2-(6-benzyl-1,2-dimethyl-5,7-dihydropyrrolo[3,4-f]indol-3-yl)acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc3c(cc2n1C)CN(Cc1ccccc1)C3 |
| InChI | InChI=1S/C21H22N2O2/c1-14-18(10-21(24)25)19-8-16-12-23(11-15-6-4-3-5-7-15)13-17(16)9-20(19)22(14)2/h3-9H,10-13H2,1-2H3,(H,24,25) |
| InChIKey | JFAJFSFPTOLHMZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|