C20H22ClNO3 — CID 91341000
2-(1-benzyl-6-chloro-5-hydroxy-2-methylindol-3-yl)acetic acid;ethane (PubChem CID 91341000) has the molecular formula C20H22ClNO3 and a molecular weight of 359.85 g/mol. Its IUPAC name is 2-(1-benzyl-6-chloro-5-hydroxy-2-methylindol-3-yl)acetic acid;ethane.
| Compound Name | 2-(1-benzyl-6-chloro-5-hydroxy-2-methylindol-3-yl)acetic acid;ethane |
|---|---|
| PubChem CID | 91341000 |
| Molecular Formula | C20H22ClNO3 |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-(1-benzyl-6-chloro-5-hydroxy-2-methylindol-3-yl)acetic acid;ethane |
| SMILES | CC.Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1Cc1ccccc1 |
| InChI | InChI=1S/C18H16ClNO3.C2H6/c1-11-13(8-18(22)23)14-7-17(21)15(19)9-16(14)20(11)10-12-5-3-2-4-6-12;1-2/h2-7,9,21H,8,10H2,1H3,(H,22,23);1-2H3 |
| InChIKey | FOQADUVHFSKHLS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|