C19H18ClNO2 — CID 165351742
2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]acetic acid (PubChem CID 165351742) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]acetic acid.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 165351742 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]acetic acid |
| SMILES | Cc1ccc2c(c1)c(CC(=O)O)c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClNO2/c1-12-3-8-18-17(9-12)16(10-19(22)23)13(2)21(18)11-14-4-6-15(20)7-5-14/h3-9H,10-11H2,1-2H3,(H,22,23) |
| InChIKey | RYVJNMHSTKLFJI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|