C18H16FNO4 — CID 18453878
2-[6-fluoro-5-hydroxy-1-[(4-hydroxyphenyl)methyl]-2-methylindol-3-yl]acetic acid (PubChem CID 18453878) has the molecular formula C18H16FNO4 and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-[6-fluoro-5-hydroxy-1-[(4-hydroxyphenyl)methyl]-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-5-hydroxy-1-[(4-hydroxyphenyl)methyl]-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453878 |
| Molecular Formula | C18H16FNO4 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-[6-fluoro-5-hydroxy-1-[(4-hydroxyphenyl)methyl]-2-methylindol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(F)cc2n1Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H16FNO4/c1-10-13(7-18(23)24)14-6-17(22)15(19)8-16(14)20(10)9-11-2-4-12(21)5-3-11/h2-6,8,21-22H,7,9H2,1H3,(H,23,24) |
| InChIKey | SMZPYERPRDHQCP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|