C17H13ClF3NO4S — CID 18453792
2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(trifluoromethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid (PubChem CID 18453792) has the molecular formula C17H13ClF3NO4S and a molecular weight of 419.81 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(trifluoromethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(trifluoromethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453792 |
| Molecular Formula | C17H13ClF3NO4S |
| Molecular Weight | 419.81 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(trifluoromethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1Cc1csc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H13ClF3NO4S/c1-8-10(4-15(24)25)11-3-14(23)12(18)5-13(11)22(8)6-9-2-16(27-7-9)26-17(19,20)21/h2-3,5,7,23H,4,6H2,1H3,(H,24,25) |
| InChIKey | GUIQTSQGIYFYRB-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.81 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|