C19H22ClNO3S — CID 91166502
2-[6-chloro-5-methoxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane (PubChem CID 91166502) has the molecular formula C19H22ClNO3S and a molecular weight of 379.91 g/mol. Its IUPAC name is 2-[6-chloro-5-methoxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane.
| Compound Name | 2-[6-chloro-5-methoxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 91166502 |
| Molecular Formula | C19H22ClNO3S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-[6-chloro-5-methoxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane |
| SMILES | CC.COc1cc2c(CC(=O)O)c(C)n(Cc3ccsc3)c2cc1Cl |
| InChI | InChI=1S/C17H16ClNO3S.C2H6/c1-10-12(6-17(20)21)13-5-16(22-2)14(18)7-15(13)19(10)8-11-3-4-23-9-11;1-2/h3-5,7,9H,6,8H2,1-2H3,(H,20,21);1-2H3 |
| InChIKey | FUUTVQGQVMKGDT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|