C16H14ClNO4S — CID 18453745
2-[6-chloro-5-hydroxy-1-[(5-hydroxythiophen-2-yl)methyl]-2-methylindol-3-yl]acetic acid (PubChem CID 18453745) has the molecular formula C16H14ClNO4S and a molecular weight of 351.81 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-1-[(5-hydroxythiophen-2-yl)methyl]-2-methylindol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-1-[(5-hydroxythiophen-2-yl)methyl]-2-methylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453745 |
| Molecular Formula | C16H14ClNO4S |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-1-[(5-hydroxythiophen-2-yl)methyl]-2-methylindol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1Cc1ccc(O)s1 |
| InChI | InChI=1S/C16H14ClNO4S/c1-8-10(5-15(20)21)11-4-14(19)12(17)6-13(11)18(8)7-9-2-3-16(22)23-9/h2-4,6,19,22H,5,7H2,1H3,(H,20,21) |
| InChIKey | NEZDFOUJFHABSC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|