C18H14ClF4NO4S — CID 18453769
2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid (PubChem CID 18453769) has the molecular formula C18H14ClF4NO4S and a molecular weight of 451.83 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 18453769 |
| Molecular Formula | C18H14ClF4NO4S |
| Molecular Weight | 451.83 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-[[5-(1,1,2,2-tetrafluoroethoxy)thiophen-3-yl]methyl]indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1Cc1csc(OC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C18H14ClF4NO4S/c1-8-10(4-15(26)27)11-3-14(25)12(19)5-13(11)24(8)6-9-2-16(29-7-9)28-18(22,23)17(20)21/h2-3,5,7,17,25H,4,6H2,1H3,(H,26,27) |
| InChIKey | UILNYCIPTHVEKC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.83 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|