C18H20ClNO3S — CID 91037019
2-[6-chloro-5-hydroxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane (PubChem CID 91037019) has the molecular formula C18H20ClNO3S and a molecular weight of 365.88 g/mol. Its IUPAC name is 2-[6-chloro-5-hydroxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane.
| Compound Name | 2-[6-chloro-5-hydroxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane |
|---|---|
| PubChem CID | 91037019 |
| Molecular Formula | C18H20ClNO3S |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 2-[6-chloro-5-hydroxy-2-methyl-1-(thiophen-3-ylmethyl)indol-3-yl]acetic acid;ethane |
| SMILES | CC.Cc1c(CC(=O)O)c2cc(O)c(Cl)cc2n1Cc1ccsc1 |
| InChI | InChI=1S/C16H14ClNO3S.C2H6/c1-9-11(5-16(20)21)12-4-15(19)13(17)6-14(12)18(9)7-10-2-3-22-8-10;1-2/h2-4,6,8,19H,5,7H2,1H3,(H,20,21);1-2H3 |
| InChIKey | HTUKLDWKWAZSED-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|