C20H14F7NO3 — CID 87323193
2-[6-fluoro-2-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]-5-(trifluoromethyl)indol-3-yl]acetic acid (PubChem CID 87323193) has the molecular formula C20H14F7NO3 and a molecular weight of 449.32 g/mol. Its IUPAC name is 2-[6-fluoro-2-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]-5-(trifluoromethyl)indol-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-2-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]-5-(trifluoromethyl)indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 87323193 |
| Molecular Formula | C20H14F7NO3 |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-[6-fluoro-2-methyl-1-[[3-(trifluoromethoxy)phenyl]methyl]-5-(trifluoromethyl)indol-3-yl]acetic acid |
| SMILES | Cc1c(CC(=O)O)c2cc(C(F)(F)F)c(F)cc2n1Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H14F7NO3/c1-10-13(7-18(29)30)14-6-15(19(22,23)24)16(21)8-17(14)28(10)9-11-3-2-4-12(5-11)31-20(25,26)27/h2-6,8H,7,9H2,1H3,(H,29,30) |
| InChIKey | GWGHLDJGKIDOBK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|