C20H19ClF3NO3 — CID 67244607
acetic acid;6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole (PubChem CID 67244607) has the molecular formula C20H19ClF3NO3 and a molecular weight of 413.82 g/mol. Its IUPAC name is acetic acid;6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole.
| Compound Name | acetic acid;6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole |
|---|---|
| PubChem CID | 67244607 |
| Molecular Formula | C20H19ClF3NO3 |
| Molecular Weight | 413.82 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | acetic acid;6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole |
| SMILES | CC(=O)O.Cc1c(C)n(Cc2cccc(OC(F)(F)F)c2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H15ClF3NO.C2H4O2/c1-11-12(2)23(17-9-14(19)6-7-16(11)17)10-13-4-3-5-15(8-13)24-18(20,21)22;1-2(3)4/h3-9H,10H2,1-2H3;1H3,(H,3,4) |
| InChIKey | TUKDFDLMCBPCCP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.82 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|