2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid

C19H19NO2 — CID 54330061

IUPAC2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid
SMILESCc1c(C)n(Cc2ccccc2)c2cc(CC(=O)O)ccc12
InChIInChI=1S/C19H19NO2/c1-13-14(2)20(12-15-6-4-3-5-7-15)18-10-16(11-19(21)22)8-9-17(13)18/h3-10H,11-12H2,1-2H3,(H,21,22)
InChIKeySXRVTAVLQHHMPO-UHFFFAOYSA-N
MW293.37 g/mol
LogP3.93
Rot. Bonds4

About 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid

2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid (PubChem CID 54330061) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid.

Molecular Properties

Compound Name2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid
PubChem CID54330061
Molecular FormulaC19H19NO2
Molecular Weight293.37 g/mol
Exact Mass293.14
IUPAC Name2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid
SMILESCc1c(C)n(Cc2ccccc2)c2cc(CC(=O)O)ccc12
InChIInChI=1S/C19H19NO2/c1-13-14(2)20(12-15-6-4-3-5-7-15)18-10-16(11-19(21)22)8-9-17(13)18/h3-10H,11-12H2,1-2H3,(H,21,22)
InChIKeySXRVTAVLQHHMPO-UHFFFAOYSA-N
XLogP3.93
TPSA42.23 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.37
LogP ≤ 53.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}

Analyze 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid?
The IUPAC name of 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid (CID 54330061) is 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid.
What is the SMILES notation for 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid?
The canonical SMILES for 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid is Cc1c(C)n(Cc2ccccc2)c2cc(CC(=O)O)ccc12.
What is the InChIKey of 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid?
The InChIKey is SXRVTAVLQHHMPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19NO2/c1-13-14(2)20(12-15-6-4-3-5-7-15)18-10-16(11-19(21)22)8-9-17(13)18/h3-10H,11-12H2,1-2H3,(H,21,22).
What are the key properties of 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid?
2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid has a molecular weight of 293.37 g/mol, XLogP of 3.93, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-benzyl-2,3-dimethylindol-6-yl)acetic acid is sourced from PubChem (CID 54330061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).