C21H27N — CID 91141046
1-[(3,4-dimethylphenyl)methyl]-2,3-dimethylindole;ethane (PubChem CID 91141046) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 1-[(3,4-dimethylphenyl)methyl]-2,3-dimethylindole;ethane.
| Compound Name | 1-[(3,4-dimethylphenyl)methyl]-2,3-dimethylindole;ethane |
|---|---|
| PubChem CID | 91141046 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 1-[(3,4-dimethylphenyl)methyl]-2,3-dimethylindole;ethane |
| SMILES | CC.Cc1ccc(Cn2c(C)c(C)c3ccccc32)cc1C |
| InChI | InChI=1S/C19H21N.C2H6/c1-13-9-10-17(11-14(13)2)12-20-16(4)15(3)18-7-5-6-8-19(18)20;1-2/h5-11H,12H2,1-4H3;1-2H3 |
| InChIKey | YEBARSXPPUJJMH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|