C17H13BrF3N — CID 59066261
3-bromo-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole (PubChem CID 59066261) has the molecular formula C17H13BrF3N and a molecular weight of 368.20 g/mol. Its IUPAC name is 3-bromo-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole.
| Compound Name | 3-bromo-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole |
|---|---|
| PubChem CID | 59066261 |
| Molecular Formula | C17H13BrF3N |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 3-bromo-2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole |
| SMILES | Cc1c(Br)c2ccccc2n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13BrF3N/c1-11-16(18)14-7-2-3-8-15(14)22(11)10-12-5-4-6-13(9-12)17(19,20)21/h2-9H,10H2,1H3 |
| InChIKey | KCZDXLOXTLNLNJ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |