C21H20F3NO2 — CID 151007121
ethyl 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate (PubChem CID 151007121) has the molecular formula C21H20F3NO2 and a molecular weight of 375.39 g/mol. Its IUPAC name is ethyl 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate.
| Compound Name | ethyl 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate |
|---|---|
| PubChem CID | 151007121 |
| Molecular Formula | C21H20F3NO2 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | ethyl 2-[2-methyl-1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]acetate |
| SMILES | CCOC(=O)Cc1c(C)n(Cc2cccc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C21H20F3NO2/c1-3-27-20(26)12-18-14(2)25(19-10-5-4-9-17(18)19)13-15-7-6-8-16(11-15)21(22,23)24/h4-11H,3,12-13H2,1-2H3 |
| InChIKey | LVIAPRRYVGLTIQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|