C25H18F3NO2 — CID 59066240
3-[(E)-2-phenylethenyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid (PubChem CID 59066240) has the molecular formula C25H18F3NO2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 3-[(E)-2-phenylethenyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid.
| Compound Name | 3-[(E)-2-phenylethenyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 59066240 |
| Molecular Formula | C25H18F3NO2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 3-[(E)-2-phenylethenyl]-1-[[3-(trifluoromethyl)phenyl]methyl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1c(/C=C/c2ccccc2)c2ccccc2n1Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H18F3NO2/c26-25(27,28)19-10-6-9-18(15-19)16-29-22-12-5-4-11-20(22)21(23(29)24(30)31)14-13-17-7-2-1-3-8-17/h1-15H,16H2,(H,30,31)/b14-13+ |
| InChIKey | NZRSPLUPDPKADP-BUHFOSPRSA-N |
| XLogP | 6.58 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |