C22H21F3N2OS — CID 178072281
1-pyrrolidin-1-yl-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]sulfanylethanone (PubChem CID 178072281) has the molecular formula C22H21F3N2OS and a molecular weight of 418.48 g/mol. Its IUPAC name is 1-pyrrolidin-1-yl-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]sulfanylethanone.
| Compound Name | 1-pyrrolidin-1-yl-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 178072281 |
| Molecular Formula | C22H21F3N2OS |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-pyrrolidin-1-yl-2-[1-[[3-(trifluoromethyl)phenyl]methyl]indol-3-yl]sulfanylethanone |
| SMILES | O=C(CSc1cn(Cc2cccc(C(F)(F)F)c2)c2ccccc12)N1CCCC1 |
| InChI | InChI=1S/C22H21F3N2OS/c23-22(24,25)17-7-5-6-16(12-17)13-27-14-20(18-8-1-2-9-19(18)27)29-15-21(28)26-10-3-4-11-26/h1-2,5-9,12,14H,3-4,10-11,13,15H2 |
| InChIKey | OSASBDVTYJUYNJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |